Basic Information
| Drug ID | DDPD15444 |
|
| Drug Name | Elexacaftor | |
| Molecular Weight | 597.66 | |
| Molecular Formula | C26H34F3N7O4S | |
| CAS Number | 2216712-66-0 | |
| SMILES | C[C@@H]1CN(C2=NC(=CC=C2C(=O)NS(=O)(=O)C2=CN(C)N=C2C)N2C=CC(OCC(C)(C)C(F)(F)F)=N2)C(C)(C)C1 | |
| External Links | ||
| DRUGBANK | DB15444 | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Water Solubility | 1000.0 | mg/L | <1 | mg/ml | Trikafta FDA Label |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 162000.0 | ng.h/ml | 162.0 | mcg.h/ml | Oral multiple dose; | DRUGBANK |
| Bioavailability | 80.0 | % | ~80 | % | PO, oral; | DRUGBANK |
| C Max | 8700.0 | ng/ml | 8.7 | mcg/ml | Oral multiple dose; | DRUGBANK |
| T Max | 6.0 | h | 6 | h | Oral multiple dose; | DRUGBANK |
| Clearance | 1.2 | L/h | 1.18 | L/h | apparent clearance; | DRUGBANK |
| Volume of Distribution | 53.7 | L | 53.7 | L | Apparent volume of distribution; | DRUGBANK |
| Half-life | 24.7 | h | ~24.7 | h | terminal half-life; | DRUGBANK |
| Eliminate Route | 87.3 | % | ~87.3 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 0.23 | % | 0.23 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 99.0 | % | >99 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1