Basic Information
| Drug ID | DDPD15328 |
|
| Drug Name | Ubrogepant | |
| Molecular Weight | 549.554 | |
| Molecular Formula | C29H26F3N5O3 | |
| CAS Number | 1374248-77-7 | |
| SMILES | C[C@@H]1[C@@H](C[C@H](NC(=O)C2=CN=C3C[C@]4(CC3=C2)C(=O)NC2=NC=CC=C42)C(=O)N1CC(F)(F)F)C1=CC=CC=C1 | |
| External Links | ||
| DRUGBANK | DB15328 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| T Max | 1.1 | h | 0.7-1.5 | h | PO, oral; | DRUGBANK | T Max | 3.1 | h | 2.7-3.5 | h | PO, oral; high-fat meal; | high-fat meal ↑ ; | DRUGBANK |
| Clearance | 87.0 | L/h | ~87 | L/h | apparent clearance; PO, oral; | DRUGBANK | |
| Volume of Distribution | 350.0 | L | 350.0 | L | Total volume of distribution; PO, oral; | DRUGBANK | |
| Half-life | 6.0 | h | 5-7 | h | elimination half-life; | DRUGBANK | |
| Eliminate Route | 42.0 | % | ~42 | % | Faeces excretion; Oral single dose; normal,healthy; human, homo sapiens; | DRUGBANK | Eliminate Route | 6.0 | % | ~6 | % | Urinary excretion; PO, oral; normal,healthy; human, homo sapiens; | DRUGBANK |
| Protein Binding | 87.0 | % | 87 | % | high protein binding; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1