Basic Information
| Drug ID | DDPD15233 |
|
| Drug Name | Avapritinib | |
| Molecular Weight | 498.57 | |
| Molecular Formula | C26H27FN10 | |
| CAS Number | 1703793-34-3 | |
| SMILES | CN1C=C(C=N1)C1=CN2N=CN=C(N3CCN(CC3)C3=NC=C(C=N3)[C@@](C)(N)C3=CC=C(F)C=C3)C2=C1 | |
| External Links | ||
| DRUGBANK | DB15233 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 15400.0 | ng.h/ml | 15400.0 | ng.h/ml | PO, oral; | DRUGBANK |
| C Max | 813.0 | ng/ml | 813.0 | ng/ml | PO, oral; | DRUGBANK |
| T Max | 3.1 | h | 2.0-4.1 | h | PO, oral; | DRUGBANK |
| Metabolic | 49.0 | % | 49 | % | Unchanged drug; | DRUGBANK | Metabolic | 35.0 | % | 35 | % | DRUGBANK | Metabolic | 14.0 | % | 14 | % | DRUGBANK |
| Clearance | 19.5 | L/h | 19.5 | L/h | apparent clearance; PO, oral; | DRUGBANK |
| Volume of Distribution | 1200.0 | L | 1200.0 | L | Apparent volume of distribution; | DRUGBANK |
| Half-life | 44.5 | h | 32-57 | h | DRUGBANK | |
| Eliminate Route | 70.0 | % | 70 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 0.23 | % | 0.23 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 7.7 | % | 7.7 | % | Faeces excretion; Unchanged drug; | DRUGBANK | Eliminate Route | 0.0400 | % | 0.04 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 98.8 | % | 98.8 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1