Basic Information
| Drug ID | DDPD14879 |
|
| Drug Name | Cefiderocol | |
| Molecular Weight | 752.21 | |
| Molecular Formula | C30H34ClN7O10S2 | |
| CAS Number | 1225208-94-5 | |
| SMILES | [H][C@]12SCC(C[N+]3(CCNC(=O)C4=C(Cl)C(O)=C(O)C=C4)CCCC3)=C(N1C(=O)[C@H]2NC(=O)C(=N/OC(C)(C)C(O)=O)\C1=CSC(N)=N1)C([O-])=O | |
| External Links | ||
| DRUGBANK | DB14879 | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | -2.265 | - | -2.265 | - | ChemSpider: Cefiderocol |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 386000.0 | ng.h/ml | 386.0 | mg.h/l | normal,healthy; | DRUGBANK | AUC | 394700.0 | ng.h/ml | 394.7 | mg.h/l | intravenous injection, IV; complicated urinary tract infections; | DRUGBANK |
| C Max | 89700.0 | ng/ml | 89.7 | mg/L | normal,healthy; | DRUGBANK | C Max | 138000.0 | ng/ml | 138.0 | mg/L | intravenous injection, IV; complicated urinary tract infections; | DRUGBANK |
| Clearance | 5.2 | L/h | 5.18 | L/h | Average clearance; | DRUGBANK |
| Volume of Distribution | 18.0 | L | 18.0 | L | Average volume of distribution; | DRUGBANK |
| Half-life | 2.5 | h | 2-3 | h | elimination half-life; | DRUGBANK |
| Eliminate Route | 98.6 | % | 98.6 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 2.8 | % | 2.8 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 89.3 | % | 89.3 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 50.0 | % | 40-60 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1