Basic Information
| Drug ID | DDPD14840 |
|
| Drug Name | Ripretinib | |
| Molecular Weight | 510.367 | |
| Molecular Formula | C24H21BrFN5O2 | |
| CAS Number | 1442472-39-0 | |
| SMILES | CCN1C(=O)C(=CC2=C1C=C(NC)N=C2)C1=C(Br)C=C(F)C(NC(=O)NC2=CC=CC=C2)=C1 | |
| External Links | ||
| DRUGBANK | DB14840 | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 5.63 | - | 5.63 | - | https://www.chemsrc.com/en/cas/1225278-16-9_525350.html |
| Boiling Point | 568.6 | ℃ | 568.6±50.0 | ℃ | http://www.chemspider.com/Chemical-Structure.67886378.html |
| pKa | 12.1 | - | 12.1 | - | https://www.chemicalbook.com/ChemicalProductProperty_EN_CB62627748.htm |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| T Max | 4.0 | h | 4 | h | PO, oral; | DRUGBANK |
| Tss | 336.0 | h | 14.0 | day | PO, oral; | DRUGBANK |
| Clearance | 47.3 | L/h | 15.3-79.2 | L/h | apparent clearance; | DRUGBANK |
| Volume of Distribution | 307.0 | L | 307.0 | L | Average volume of distribution; | DRUGBANK |
| Half-life | 14.8 | h | 14.8 | h | DRUGBANK | |
| Eliminate Route | 34.0 | % | 34 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 0.20 | % | 0.2 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 99.0 | % | >99 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1