Basic Information
| Drug ID | DDPD14754 |
|
| Drug Name | Solriamfetol | |
| Molecular Weight | 194.234 | |
| Molecular Formula | C10H14N2O2 | |
| CAS Number | 178429-62-4 | |
| SMILES | N[C@@H](COC(N)=O)CC1=CC=CC=C1 | |
| External Links | ||
| DRUGBANK | DB14754 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 95.0 | % | ~95 | % | PO, oral; | DRUGBANK |
| T Max | 2.0 | h | 2(1.25-3) | h | PO, oral; fasting; | DRUGBANK | T Max | 3.0 | h | 3.0 | h | PO, oral; high-fat meal; | DRUGBANK |
| Metabolic | 1.0 | % | <1 | % | DRUGBANK | |
| Clearance | 18.2 | L/h | 18.2 | L/h | Renal clearance; | DRUGBANK | Clearance | 19.5 | L/h | 19.5 | L/h | Total clearance; | DRUGBANK | Clearance | 18.4 | L/h | 18.4±4.2 | L/h | fasting; | DRUGBANK | Clearance | 18.4 | L/h | 18.8±4.2 | L/h | food; | DRUGBANK |
| Volume of Distribution | 199.0 | L | 199.0 | L | DRUGBANK | Volume of Distribution | 158.2 | L | 158.2±37.3 | L | fasting; | DRUGBANK | Volume of Distribution | 159.8 | L | 159.8±38.9 | L | food; | DRUGBANK |
| Half-life | 7.1 | h | 7.1 | h | DRUGBANK | Half-life | 6.1 | h | 6.1±1.2 | h | fasting; | DRUGBANK | Half-life | 5.9 | h | 5.9±1.2 | h | food; | DRUGBANK |
| Protein Binding | 16.4 | % | 13.3-19.4 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1