Basic Information
| Drug ID | DDPD14568 |
|
| Drug Name | Ivosidenib | |
| Molecular Weight | 582.97 | |
| Molecular Formula | C28H22ClF3N6O3 | |
| CAS Number | 1448347-49-6 | |
| SMILES | [H][C@@](N(C(=O)[C@]1([H])CCC(=O)N1C1=NC=CC(=C1)C#N)C1=CC(F)=CN=C1)(C(=O)NC1CC(F)(F)C1)C1=C(Cl)C=CC=C1 | |
| External Links | ||
| DRUGBANK | DB14568 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| T Max | 3.0 | h | 3 | h | PO, oral; | DRUGBANK |
| Tss | 336.0 | h | 14.0 | day | Oral multiple dose; | DRUGBANK |
| Metabolic | 8.0 | % | <8 | % | DRUGBANK | |
| Clearance | 4.3 | L/h | 4.3 | L/h | apparent clearance; | DRUGBANK |
| Volume of Distribution | 234.0 | L | 234.0 | L | Apparent volume of distribution; at steady state; | DRUGBANK |
| Half-life | 93.0 | h | 93 | h | terminal half-life; | DRUGBANK |
| Eliminate Route | 0.77 | % | 0.77 | % | Faeces excretion; PO, oral; | DRUGBANK | Eliminate Route | 0.17 | % | 0.17 | % | Urinary excretion; PO, oral; | DRUGBANK |
| Protein Binding | 94.0 | % | 92-96 | % | plasma proteins; high protein binding; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1