| Drug ID | DDPD14002 |
|
| Drug Name | D-alpha-Tocopherol acetate | |
| Molecular Weight | 472.7428 | |
| Molecular Formula | C31H52O3 | |
| CAS Number | 58-95-7 | |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCC2=C(C)C(OC(C)=O)=C(C)C(C)=C2O1 | |
| External Links | ||
| DRUGBANK | DB14002 | |
Not Available
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 65.0 | % | 50-80 | % | PO, oral; | DRUGBANK |
Not Available