Basic Information
| Drug ID | DDPD13985 |
|
| Drug Name | Lutetium Lu 177 dotatate | |
| Molecular Weight | 1609.55 | |
| Molecular Formula | C65H87LuN14O19S2 | |
| CAS Number | 437608-50-9 | |
| SMILES | [177Lu+3].C[C@@H](O)[C@H](NC(=O)[C@@H]1CSSC[C@H](NC(=O)[C@@H](CC2=CC=CC=C2)NC(=O)CN2CCN(CC([O-])=O)CCN(CC([O-])=O)CCN(CC([O-])=O)CC2)C(=O)N[C@@H](CC2=CC=C(O)C=C2)C(=O)N[C@H](CC2=CNC3=C2C=CC=C3)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1)C(O)=O | |
| External Links | ||
| DRUGBANK | DB13985 | |
| PDR | 24192 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 41.0 | ng.h/ml | 41.0 | ng.h/ml | intravenous injection, IV; | DRUGBANK |
| C Max | 10000000.0 | ng/ml | 10 | mg/ml | intravenous injection, IV; | DRUGBANK |
| Metabolic | 0 | % | 0 | % | Liver metabolism; | DRUGBANK |
| Clearance | 4.5 | L/h | 4.5 | L/h | Average clearance; | DRUGBANK |
| Volume of Distribution | 460.0 | L | 460.0 | L | Average volume of distribution; | DRUGBANK |
| Half-life | 3.5 | h | 3.5±1.4 | h | effective half-life; | DRUGBANK | Half-life | 71.0 | h | 71±28 | h | terminal half-life; | DRUGBANK |
| Eliminate Route | 44.0 | % | 44 | % | Urinary excretion; intravenous infusion, IV in drop; | DRUGBANK | Eliminate Route | 58.0 | % | 58 | % | Urinary excretion; intravenous infusion, IV in drop; | DRUGBANK | Eliminate Route | 65.0 | % | 65 | % | Urinary excretion; intravenous infusion, IV in drop; | DRUGBANK |
| Protein Binding | 43.0 | % | 43 | % | plasma proteins; human, homo sapiens; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 7.4 | GBq | 7.4 | GBq | intravenous injection, IV | Lutathera | lutetium lu 177 dotatate | PDR |
| Max dose for adults | 200.0 | mCi | 200 | mCi | intravenous injection, IV | Lutathera | lutetium lu 177 dotatate | PDR |
| Max dose for geriatric | 7.4 | GBq | 7.4 | GBq | intravenous injection, IV | Lutathera | lutetium lu 177 dotatate | PDR |
| Max dose for geriatric | 200.0 | mCi | 200 | mCi | intravenous injection, IV | Lutathera | lutetium lu 177 dotatate | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1