| Drug ID | DDPD13944 |
|
| Drug Name | Testosterone enanthate | |
| Molecular Weight | 400.594 | |
| Molecular Formula | C26H40O3 | |
| CAS Number | 315-37-7 | |
| SMILES | [H][C@@]12CC[C@H](OC(=O)CCCCCC)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C | |
| External Links | ||
| DRUGBANK | DB13944 | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 3.58 | - | 3.58 | - | Anti-catabolic steroids |
| Melting Point | 36.5 | ℃ | 34-39 | ℃ | 'MSDS' |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| C Max | 120000.0 | ng/ml | 1200 | ng/dl | Multiple dose; | DRUGBANK |
| Volume of Distribution | 1.0 | L/kg | 1.0 | L/kg | intravenous injection, IV; | DRUGBANK |
| Half-life | 192.0 | h | 7-9 | day | DRUGBANK | |
| Eliminate Route | 90.0 | % | ~90 | % | Urinary excretion; IM,intramuscular injection; | DRUGBANK | Eliminate Route | 6.0 | % | ~6 | % | Faeces excretion; IM,intramuscular injection; | DRUGBANK |
Not Available