| Drug ID | DDPD13854 |
|
| Drug Name | Gamolenic acid | |
| Molecular Weight | 278.4296 | |
| Molecular Formula | C18H30O2 | |
| CAS Number | 506-26-3 | |
| SMILES | CCCCC\C=C/C\C=C/C\C=C/CCCCC(O)=O | |
| External Links | ||
| DRUGBANK | DB13854 | |
Not Available
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Tss | 168.0 | h | 7 | day | PO, oral; fasting; | DRUGBANK |
| Toxicity TDLo | 0.13 | mg/kg/day | 3.14 | mg/kg/24D | Male, men; | DRUGBANK |
Not Available