| Drug ID | DDPD13274 |
|
| Drug Name | Micronomicin | |
| Molecular Weight | 463.576 | |
| Molecular Formula | C20H41N5O7 | |
| CAS Number | 52093-21-7 | |
| SMILES | CNC[C@@H]1CC[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3OC[C@](C)(O)[C@H](NC)[C@H]3O)[C@H]2O)O1 | |
| External Links | ||
| DRUGBANK | DB13274 | |
Not Available
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Clearance | 0.0660 | L/h/kg | 1.1 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 0.15 | L/kg | 0.15 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 2.1 | h | 2.1 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
Not Available