Basic Information
| Drug ID | DDPD12674 |
|
| Drug Name | Lurbinectedin | |
| Molecular Weight | 784.88 | |
| Molecular Formula | C41H44N4O10S | |
| CAS Number | 497871-47-3 | |
| SMILES | [H][C@@]12[C@@H]3SC[C@]4(NCCC5=C4NC4=CC=C(OC)C=C54)C(=O)OC[C@H](N1[C@@H](O)[C@@H]1CC4=CC(C)=C(OC)C(O)=C4[C@@]2([H])N1C)C1=C2OCOC2=C(C)C(OC(C)=O)=C31 | |
| External Links | ||
| DRUGBANK | DB12674 | |
| PubChem Compound | 57327016 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 551.0 | ng.h/ml | 551.0 | ug.h/L | intravenous injection, IV; | DRUGBANK |
| C Max | 107.0 | ng/ml | 107 | ug/L | intravenous injection, IV; | DRUGBANK |
| Clearance | 11.0 | L/h | ~11 | L/h | Plasma clearance; | DRUGBANK | Clearance | 0.17 | L/h/kg | 2.76 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 504.0 | L | 504.0 | L | Steady state volume of distribution; | DRUGBANK | Volume of Distribution | 7.3 | L/kg | 7.3 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 51.0 | h | 51 | h | terminal half-life; | DRUGBANK | Half-life | 50.7 | h | 50.68 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 89.0 | % | ~89 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 6.0 | % | 6 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 0.18 | % | ~0.178 | % | Faeces excretion; Unchanged drug; | DRUGBANK | Eliminate Route | 0.0600 | % | 0.06 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 99.0 | % | ~99 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1