| Drug ID | DDPD11921 |
|
| Drug Name | Deflazacort | |
| Molecular Weight | 441.524 | |
| Molecular Formula | C25H31NO6 | |
| CAS Number | 14484-47-0 | |
| SMILES | [H][C@@]12C[C@@]3([H])[C@]4([H])CCC5=CC(=O)C=C[C@]5(C)[C@@]4([H])[C@@]([H])(O)C[C@]3(C)[C@@]1(N=C(C)O2)C(=O)COC(C)=O | |
| External Links | ||
| DRUGBANK | DB11921 | |
| PubChem Compound | 189821 | |
| PDR | 24042 | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.4 | - | 2.4 | - | https://www.accessdata.fda.gov/drugsatfda_docs/nda/2017/208684,208685Orig1s000ClinPharmR.pdf |
| Melting Point | 215.0 | ℃ | >215 | ℃ | https://www.trc-canada.com/product-detail/?D228975 |
| Water Solubility | 108.0 | mg/L | 108 | μg/ml | https://pdfs.semanticscholar.org/1eb8/8a36cea3d298d2253b27bb1a03f829871dac.pdf |
| pKa | 5.52 | - | 5.52 | - | https://www.accessdata.fda.gov/drugsatfda_docs/nda/2017/208684,208685Orig1s000ClinPharmR.pdf |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 280.0 | ng.h/ml | 280.0 | ng.h/ml | PO, oral; | DRUGBANK |
| T Max | 1.5 | h | 1-2 | h | PO, oral; | DRUGBANK |
| Clearance | 114.0 | L/h | 114±27 | L/h | DRUGBANK | |
| Volume of Distribution | 204.0 | L | 204±84 | L | DRUGBANK | |
| Half-life | 1.5 | h | 1.1-1.9 | h | DRUGBANK | |
| Toxicity LD50 | 5200.0 | mg/kg | 5200.0 | mg/kg | PO, oral; mouse; | DRUGBANK |
| Toxicity TDLo | 0.12 | mg/kg | 0.12 | mg/kg | PO, oral; Female, women; | DRUGBANK |
| Eliminate Route | 70.0 | % | ~70 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 30.0 | % | ~30 | % | Faeces excretion; | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Frequency | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|---|
| Max dose for children | 0.9 | mg/kg/day | 0.9 | mg/kg/dose | PO, oral | qd | Emflaza | deflazacort | PDR |
| Max dose for adolescents | 0.9 | mg/kg/dose | 0.9 | mg/kg/dose | PO, oral | qd | Emflaza | deflazacort | PDR |
| Max dose for adults | 0.9 | mg/kg/day | 0.9 | mg/kg/dose | PO, oral | qd | Emflaza | deflazacort | PDR |