| Drug ID | DDPD11761 |
|
| Drug Name | Tenapanor | |
| Molecular Weight | 1145.04 | |
| Molecular Formula | C50H66Cl4N8O10S2 | |
| CAS Number | 1234423-95-0 | |
| SMILES | CN1C[C@@H](C2=CC(=CC=C2)S(=O)(=O)NCCOCCOCCNC(=O)NCCCCNC(=O)NCCOCCOCCNS(=O)(=O)C2=CC(=CC=C2)[C@@H]2CN(C)CC3=C2C=C(Cl)C=C3Cl)C2=C(C1)C(Cl)=CC(Cl)=C2 | |
| External Links | ||
| DRUGBANK | DB11761 | |
| PubChem Compound | 71587953 | |
Not Available
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Eliminate Route | 70.0 | % | 70 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 79.0 | % | 79 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 9.0 | % | 9 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 65.0 | % | ~65 | % | Unchanged drug; | DRUGBANK |
| Protein Binding | 99.0 | % | 99 | % | plasma proteins; | DRUGBANK |
Not Available