Basic Information
| Drug ID | DDPD11753 |
|
| Drug Name | Rifamycin | |
| Molecular Weight | 697.778 | |
| Molecular Formula | C37H47NO12 | |
| CAS Number | 6998-60-3 | |
| SMILES | CO[C@H]1\C=C\O[C@@]2(C)OC3=C(C)C(O)=C4C(O)=C(NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C)C=C(O)C4=C3C2=O | |
| External Links | ||
| DRUGBANK | DB11753 | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 5.0 | - | 5.0 | - | Shu-Wen L., Chun-Jung L. and Jyh-Chin Y. (2017). Expert Opinion in Pharmacotherapy. Vol 18. |
| Boiling Point | 972.8 | ℃ | 972.8 | ℃ | 'MSDS' |
| Melting Point | 171.0 | ℃ | 171 | ℃ | 'MSDS' |
| pKa | 1.8 | - | 1.8 | - | Stefano A., Rusca A., Loprete L., Droge M., Moro L. and Assandri A. (2011). Antimicrob Agents Chemother. |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 11840.0 | ng.h/ml | 11.84 | mg.h/l | PO, oral; | DRUGBANK |
| Bioavailability | 0.10 | % | <0.1 | % | PO, oral; patients; | DRUGBANK |
| C Max | 2.0 | ng/ml | <2 | ng/ml | PO, oral; patients; | DRUGBANK | C Max | 36000.0 | ng/ml | 36 | mg/L | PO, oral; | DRUGBANK |
| T Max | 0.0833 | h | 5 | min | PO, oral; | DRUGBANK |
| Clearance | 23.3 | L/h | 23.3 | L/h | DRUGBANK | |
| Volume of Distribution | 101.8 | L | 101.8 | L | DRUGBANK | |
| Half-life | 3.0 | h | 3 | h | DRUGBANK | |
| Eliminate Route | 18.0 | % | 18 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 50.0 | % | 50 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 21.0 | % | 21 | % | Faeces excretion; | DRUGBANK |
| Protein Binding | 87.5 | % | ~80-95 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1