Basic Information
| Drug ID | DDPD11691 |
|
| Drug Name | Naldemedine | |
| Molecular Weight | 570.646 | |
| Molecular Formula | C32H34N4O6 | |
| CAS Number | 916072-89-4 | |
| SMILES | [H][C@@]12OC3=C4C(C[C@@]5([H])N(CC6CC6)CC[C@@]14[C@@]5(O)CC(C(=O)NC(C)(C)C1=NC(=NO1)C1=CC=CC=C1)=C2O)=CC=C3O | |
| External Links | ||
| DRUGBANK | DB11691 | |
| PubChem Compound | 54732242 | |
| PDR | 24065 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| T Max | 0.75 | h | 0.75 | h | DRUGBANK | T Max | 2.5 | h | 2.5 | h | PO, oral; high-fat meal; | high-fat meal ↑ ; | DRUGBANK |
| Volume of Distribution | 155.0 | L | 155.0 | L | Apparent volume of distribution; | DRUGBANK | |
| Half-life | 11.0 | h | 11 | h | elimination half-life; | DRUGBANK | |
| Eliminate Route | 57.0 | % | 57 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 35.0 | % | 35 | % | Faeces excretion; | DRUGBANK |
| Protein Binding | 93.5 | % | 93-94 | % | plasma proteins; human, homo sapiens; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Frequency | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 0.2 | mg/day | 0.2 | mg/day | PO, oral | qd | Symproic | naldemedine | PDR |
| Max dose for geriatric | 0.2 | mg/day | 0.2 | mg/day | PO, oral | qd | Symproic | naldemedine | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1