Basic Information
| Drug ID | DDPD11653 |
|
| Drug Name | Bremelanotide | |
| Molecular Weight | 1025.182 | |
| Molecular Formula | C50H68N14O10 | |
| CAS Number | 189691-06-3 | |
| SMILES | CCCC[C@H](NC(C)=O)C(=O)N[C@H]1CC(=O)NCCCC[C@H](NC(=O)[C@H](CC2=CNC3=CC=CC=C23)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](CC2=CC=CC=C2)NC(=O)[C@H](CC2=CN=CN2)NC1=O)C(O)=O | |
| External Links | ||
| DRUGBANK | DB11653 | |
| PubChem Compound | 9941379 | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Boiling Point | 230.0 | ℃ | 230 | ℃ | MSDS |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 276.0 | ng.h/ml | 276.0 | ng.h/ml | DRUGBANK | |
| Bioavailability | 100.0 | % | 100 | % | DRUGBANK | |
| C Max | 72.8 | ng/ml | 72.8 | ng/ml | DRUGBANK | |
| T Max | 1.0 | h | 1(0.5-1) | h | DRUGBANK | |
| Clearance | 6.5 | L/h | 6.5±1.0 | L/h | Average clearance; | DRUGBANK |
| Volume of Distribution | 25.0 | L | 25.0±5.8 | L | Average volume of distribution; | DRUGBANK |
| Half-life | 2.7 | h | 2.7(1.9-4.0) | h | DRUGBANK | |
| Eliminate Route | 64.8 | % | 64.8 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 22.8 | % | 22.8 | % | Faeces excretion; | DRUGBANK |
| Protein Binding | 21.0 | % | 21 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1