Basic Information
| Drug ID | DDPD11642 |
|
| Drug Name | Pitolisant | |
| Molecular Weight | 295.85 | |
| Molecular Formula | C17H26ClNO | |
| CAS Number | 362665-56-3 | |
| SMILES | ClC1=CC=C(CCCOCCCN2CCCCC2)C=C1 | |
| External Links | ||
| DRUGBANK | DB11642 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 90.0 | % | 90 | % | PO, oral; | DRUGBANK |
| AUC | 812.0 | ng.h/ml | 812.0 | ng.h/ml | Oral multiple dose; | DRUGBANK |
| C Max | 30.0 | ng/ml | ~30 | ng/ml | PO, oral; | DRUGBANK | C Max | 73.0 | ng/ml | 73 | ng/ml | Oral multiple dose; | DRUGBANK |
| T Max | 3.0 | h | 3 | h | PO, oral; | DRUGBANK |
| Tss | 132.0 | h | 5-6 | day | PO, oral; | DRUGBANK |
| Clearance | 43.9 | L/h | 43.9 | L/h | apparent clearance; Oral single dose; | DRUGBANK |
| Volume of Distribution | 1912.5 | L | 1000-2825 | L | Apparent volume of distribution; PO, oral; adults; | DRUGBANK |
| Half-life | 11.0 | h | 10-12 | h | elimination half-life; | DRUGBANK | Half-life | 20.0 | h | ~20 | h | Single dose; | DRUGBANK |
| Eliminate Route | 25.0 | % | ~25 | % | lung excretion; | DRUGBANK | Eliminate Route | 3.0 | % | <3 | % | Faeces excretion; | DRUGBANK |
| Protein Binding | 93.5 | % | ~91-96 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1