Basic Information
| Drug ID | DDPD11637 |
|
| Drug Name | Delamanid | |
| Molecular Weight | 534.492 | |
| Molecular Formula | C25H25F3N4O6 | |
| CAS Number | 681492-22-8 | |
| SMILES | C[C@]1(COC2=CC=C(C=C2)N2CCC(CC2)OC2=CC=C(OC(F)(F)F)C=C2)CN2C=C(N=C2O1)[N+]([O-])=O | |
| External Links | ||
| DRUGBANK | DB11637 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 47.5 | % | 35-60 | % | PO, oral; mouse; Rattus, Rat; dog; | DRUGBANK | Bioavailability | 36.0 | % | 25-47 | % | PO, oral; human, homo sapiens; | DRUGBANK |
| C Max | 135.0 | ng/ml | 135 | ng/ml | Oral single dose; | DRUGBANK |
| Tss | 288.0 | h | 10-14 | day | PO, oral; | DRUGBANK |
| Volume of Distribution | 2100.0 | L | 2100.0 | L | Apparent volume of distribution; | DRUGBANK |
| Half-life | 34.0 | h | 30-38 | h | DRUGBANK | |
| Eliminate Route | 5.0 | % | <5 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 99.5 | % | >99.5 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1