Basic Information
| Drug ID | DDPD11633 |
|
| Drug Name | Isavuconazole | |
| Molecular Weight | 437.47 | |
| Molecular Formula | C22H17F2N5OS | |
| CAS Number | 241479-67-4 | |
| SMILES | C[C@@H](C1=NC(=CS1)C1=CC=C(C=C1)C#N)[C@](O)(CN1C=NC=N1)C1=C(F)C=CC(F)=C1 | |
| External Links | ||
| DRUGBANK | DB11633 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 189462.8 | ng.h/ml | 189462.8 | ng.h/ml | PO, oral; | DRUGBANK | AUC | 193906.8 | ng.h/ml | 193906.8 | ng.h/ml | intravenous injection, IV; | DRUGBANK |
| Bioavailability | 98.0 | % | 98 | % | Oral single dose; | DRUGBANK |
| C Max | 7499.0 | ng/ml | 7499 | ng/ml | PO, oral; | DRUGBANK | C Max | 20028.0 | ng/ml | 20028 | ng/ml | PO, oral; | DRUGBANK |
| T Max | 2.5 | h | 2-3 | h | Oral single dose; | DRUGBANK | T Max | 2.5 | h | 2-3 | h | Oral multiple dose; | DRUGBANK |
| Clearance | 2.5 | L/h | 2.5±1.6 | L/h | PO, oral; intravenous injection, IV; | DRUGBANK | Clearance | 0.0510 | L/h/kg | 0.85 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 450.0 | L | 450.0 | L | Steady state volume of distribution; intravenous injection, IV; | DRUGBANK | Volume of Distribution | 5.4 | L/kg | 5.37 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 130.0 | h | 130 | h | elimination half-life; normal,healthy; | DRUGBANK | Half-life | 130.0 | h | 130 | h | elimination half-life; patients; | DRUGBANK | Half-life | 110.0 | h | 110 | h | PO, oral; | DRUGBANK | Half-life | 115.0 | h | 115 | h | intravenous injection, IV; | DRUGBANK | Half-life | 86.9 | h | 86.9 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 46.1 | % | 46.1 | % | Faeces excretion; PO, oral; | DRUGBANK | Eliminate Route | 45.5 | % | ~45.5 | % | Urinary excretion; PO, oral; | DRUGBANK | Eliminate Route | 1.0 | % | <1 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 99.0 | % | >99 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1