| Drug ID | DDPD11596 |
|
| Drug Name | Levoleucovorin | |
| Molecular Weight | 473.4393 | |
| Molecular Formula | C20H23N7O7 | |
| CAS Number | 68538-85-2 | |
| SMILES | NC1=NC(=O)C2=C(NC[C@H](CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)N2C=O)N1 | |
| External Links | ||
| DRUGBANK | DB11596 | |
| PubChem Compound | 149436 | |
| PDR | 23984 | |
| Drugs.com | Drugs.com Drug Page | |
Not Available
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| C Max | 1722.0 | ng/ml | 1722 | ng/ml | intravenous injection, IV; Derivative; | DRUGBANK | C Max | 275.0 | ng/ml | 275 | ng/ml | intravenous injection, IV; Derivative; | DRUGBANK |
| T Max | 0.90 | h | 0.9 | h | intravenous injection, IV; Derivative; | DRUGBANK |
| Clearance | 0.25 | L/h/kg | 4.1 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 0.27 | L/kg | 0.27 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 5.1 | h | 5.1 | h | terminal half-life; | DRUGBANK | Half-life | 6.8 | h | 6.8 | h | terminal half-life; | DRUGBANK | Half-life | 1.1 | h | 1.1 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 575.0 | mg/kg | 575.0 | mg/kg | adults; mouse; | DRUGBANK | Toxicity LD50 | 378.0 | mg/kg | 378.0 | mg/kg | adults; Rattus, Rat; | DRUGBANK |
Not Available