| Drug ID | DDPD11587 |
|
| Drug Name | Etafedrine | |
| Molecular Weight | 193.29 | |
| Molecular Formula | C12H19NO | |
| CAS Number | 48141-64-6 | |
| SMILES | CCN(C)[C@@H](C)[C@H](O)C1=CC=CC=C1 | |
| External Links | ||
| DRUGBANK | DB11587 | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Melting Point | 109.0 | ℃ | 108-110 | ℃ | MSDS |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 100.0 | % | 100 | % | PO, oral; | DRUGBANK |
| C Max | 100.0 | ng/ml | 0.10 | mg/L | PO, oral; | DRUGBANK |
| T Max | 1.0 | h | 1 | h | PO, oral; | DRUGBANK |
| Volume of Distribution | 3.0 | L/kg | 3.0 | L/kg | DRUGBANK | |
| Half-life | 4.5 | h | 3-6 | h | elimination half-life; | DRUGBANK |
Not Available