| Drug ID | DDPD11584 |
|
| Drug Name | Pipradrol | |
| Molecular Weight | 267.372 | |
| Molecular Formula | C18H21NO | |
| CAS Number | 467-60-7 | |
| SMILES | [H]N1CCCCC1C(O)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| External Links | ||
| DRUGBANK | DB11584 | |
Not Available
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Toxicity LD50 | 180.0 | mg/kg | 180.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 120.0 | mg/kg | 120.0 | mg/kg | PO, oral; mouse; | DRUGBANK | Toxicity LD50 | 180.0 | mg/kg | 180.0 | mg/kg | PO, oral; rabbit; | DRUGBANK |
| Eliminate Route | 3.5 | % | 3.5 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 5.0 | % | 5 | % | Faeces excretion; | DRUGBANK |
Not Available