Basic Information
| Drug ID | DDPD11274 |
|
| Drug Name | Dihydro-alpha-ergocryptine | |
| Molecular Weight | 577.726 | |
| Molecular Formula | C32H43N5O5 | |
| CAS Number | 25447-66-9 | |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](CC(C)C)N1C(=O)[C@](NC(=O)[C@H]3CN(C)[C@]4([H])CC5=CNC6=CC=CC(=C56)[C@@]4([H])C3)(O[C@@]21O)C(C)C | |
| External Links | ||
| DRUGBANK | DB11274 | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 5.9 | - | 5.9 | - | Yasuda, et al. The Journal of Pharmacology and Experimental Therapeutics. (2002) |
| Melting Point | 117.0 | ℃ | 117 | ℃ | LabNetwork |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 5.0 | % | <5 | % | DRUGBANK | |
| C Max | 2.2 | ng/ml | 2157 | pg/ml | Oral multiple dose; | DRUGBANK |
| T Max | 1.3 | h | 0.5-2 | h | DRUGBANK | T Max | 1.0 | h | 1 | h | Oral multiple dose; | DRUGBANK |
| Clearance | 1.1 | L/h | 1.129 | L/h | intravenous injection, IV; | DRUGBANK | Clearance | 26.0 | L/h | 25.98 | L/h | PO, oral; | DRUGBANK |
| Volume of Distribution | 11.1 | L | 11.054 | L | intravenous injection, IV; | DRUGBANK | Volume of Distribution | 218.6 | L | 218.63 | L | PO, oral; | DRUGBANK |
| Half-life | 14.0 | h | 12-16 | h | Parkinson; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1