| Drug ID | DDPD11256 |
|
| Drug Name | Levomefolic acid | |
| Molecular Weight | 459.4558 | |
| Molecular Formula | C20H25N7O6 | |
| CAS Number | 31690-09-2 | |
| SMILES | CN1[C@@H](CNC2=CC=C(C=C2)C(=O)N[C@@H](CCC(O)=O)C(O)=O)CNC2=C1C(=O)N=C(N)N2 | |
| External Links | ||
| DRUGBANK | DB11256 | |
| PubChem Compound | 444412 | |
| Drugs.com | Drugs.com Drug Page | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Boiling Point | 221.0 | ℃ | 221 | ℃ | MSDS |
| Water Solubility | 300.0 | mg/L | 0.3 | mg/ml | Cayman Chemical Safety Data Sheet |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| C Max | 18.1 | ng/ml | 39.4 | nmol/L | Oral single dose; Female, women; | DRUGBANK |
| Half-life | 3.0 | h | ~3 | h | elimination half-life; PO, oral; | DRUGBANK |
| Protein Binding | 56.0 | % | ~56 | % | plasma proteins; | DRUGBANK |
Not Available