| Drug ID | DDPD11221 |
|
| Drug Name | Dioxybenzone | |
| Molecular Weight | 244.246 | |
| Molecular Formula | C14H12O4 | |
| CAS Number | 131-53-3 | |
| SMILES | COC1=CC(O)=C(C=C1)C(=O)C1=CC=CC=C1O | |
| External Links | ||
| DRUGBANK | DB11221 | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Boiling Point | 172.5 | ℃ | 172.5 | ℃ | MSDS |
| Melting Point | 74.0 | ℃ | 74 | ℃ | MSDS |
Not Available
Not Available