Basic Information
| Drug ID | DDPD09330 |
|
| Drug Name | Osimertinib | |
| Molecular Weight | 499.619 | |
| Molecular Formula | C28H33N7O2 | |
| CAS Number | 1421373-65-0 | |
| SMILES | COC1=C(NC2=NC=CC(=N2)C2=CN(C)C3=C2C=CC=C3)C=C(NC(=O)C=C)C(=C1)N(C)CCN(C)C | |
| External Links | ||
| DRUGBANK | DB09330 | |
| PubChem Compound | 71496458 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| T Max | 6.0 | h | 6 | h | DRUGBANK | |
| Clearance | 14.2 | L/h | 14.2 | L/h | PO, oral; | DRUGBANK |
| Volume of Distribution | 986.0 | L | 986.0 | L | Average volume of distribution; at steady state; | DRUGBANK |
| Half-life | 48.0 | h | 48 | h | DRUGBANK | |
| Eliminate Route | 68.0 | % | 68 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 14.0 | % | 14 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 2.0 | % | 2 | % | Unchanged drug; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1