Basic Information
| Drug ID | DDPD09280 |
|
| Drug Name | Lumacaftor | |
| Molecular Weight | 452.414 | |
| Molecular Formula | C24H18F2N2O5 | |
| CAS Number | 936727-05-8 | |
| SMILES | CC1=CC=C(NC(=O)C2(CC2)C2=CC=C3OC(F)(F)OC3=C2)N=C1C1=CC(=CC=C1)C(O)=O | |
| External Links | ||
| DRUGBANK | DB09280 | |
| PubChem Compound | 16678941 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| T Max | 4.0 | h | 4 | h | PO, oral; high-fat meal; | DRUGBANK |
| Clearance | 2.4 | L/h | 2.38 | L/h | apparent clearance; | DRUGBANK |
| Volume of Distribution | 86.0 | L | 86.0 (69.8) | L | Apparent volume of distribution; PO, oral; Cystic fibrosis; patients; | DRUGBANK |
| Half-life | 26.0 | h | ~26 | h | DRUGBANK | |
| Eliminate Route | 51.0 | % | 51 | % | Faeces excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 99.0 | % | 99 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1