| Drug ID | DDPD09270 |
|
| Drug Name | Ubidecarenone | |
| Molecular Weight | 863.3435 | |
| Molecular Formula | C59H90O4 | |
| CAS Number | 303-98-0 | |
| SMILES | COC1=C(OC)C(=O)C(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)=C(C)C1=O | |
| External Links | ||
| DRUGBANK | DB09270 | |
| PubChem Compound | 5281915 | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 10.0 | - | 10.0 | - | Lucangioli S. and Tripodi V., Der Pharmacia Sinica, (2012), 3 (4):406-407 |
| Melting Point | 51.0 | ℃ | 50-52 | ℃ | MSDS |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 11510.0 | ng.h/ml | 11.51 | mcg.h/ml | PO, oral; | DRUGBANK |
| C Max | 320.0 | ng/ml | 0.32 | mcg/ml | PO, oral; | DRUGBANK |
| T Max | 7.9 | h | 7.9 | h | PO, oral; | DRUGBANK |
| Tss | 504.0 | h | 3 | week | PO, oral; | DRUGBANK |
| Clearance | 0.001180 | L/h/kg | 1.18 | ml/h/kg | Total clearance; | DRUGBANK |
| Volume of Distribution | 20.4 | L/kg | 20.4 | L/kg | DRUGBANK | |
| Half-life | 21.7 | h | 21.7 | h | DRUGBANK | |
| Eliminate Route | 60.0 | % | >60 | % | Faeces excretion; PO, oral; | DRUGBANK | Eliminate Route | 8.3 | % | 8.3 | % | Urinary excretion; PO, oral; | DRUGBANK | Eliminate Route | 60.0 | % | >60 | % | Faeces excretion; PO, oral; Unchanged drug; | DRUGBANK |
Not Available