Basic Information
| Drug ID | DDPD09183 |
|
| Drug Name | Dasabuvir | |
| Molecular Weight | 493.58 | |
| Molecular Formula | C26H27N3O5S | |
| CAS Number | 1132935-63-7 | |
| SMILES | COC1=C(C=C(C=C1C1=CC2=CC=C(NS(C)(=O)=O)C=C2C=C1)N1C=CC(=O)NC1=O)C(C)(C)C | |
| External Links | ||
| DRUGBANK | DB09183 | |
| PubChem Compound | 56640146 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 70.0 | % | 70 | % | DRUGBANK | |
| T Max | 4.0 | h | 4 | h | DRUGBANK | |
| Volume of Distribution | 149.0 | L | 149.0 | L | DRUGBANK | Volume of Distribution | 2.1 | L/kg | 2.13 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 5.8 | h | 5.5-6 | h | elimination half-life; | DRUGBANK | Half-life | 5.7 | h | 5.7 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 94.4 | % | 94.4 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 2.0 | % | 2 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 99.5 | % | >99.5 | % | plasma proteins; human, homo sapiens; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1