| Drug ID | DDPD09156 |
|
| Drug Name | Iopromide | |
| Molecular Weight | 791.1119 | |
| Molecular Formula | C18H24I3N3O8 | |
| CAS Number | 73334-07-3 | |
| SMILES | COCC(=O)NC1=C(I)C(C(=O)N(C)CC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I | |
| External Links | ||
| DRUGBANK | DB09156 | |
| PubChem Compound | 3736 | |
| PDR | 1011 | |
| Drugs.com | Drugs.com Drug Page | |
Not Available
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Metabolic | 0 | % | 0 | % | DRUGBANK | |
| Clearance | 6.4 | L/h | 107.0 | ml/min | Average clearance; | DRUGBANK | Clearance | 6.2 | L/h | 104.0 | ml/min | Renal clearance; | DRUGBANK | Clearance | 0.0840 | L/h/kg | 1.4 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 16.0 | L | 16.0 | L | DRUGBANK | Volume of Distribution | 0.22 | L/kg | 0.22 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 0.24 | h | 0.24 | h | distribution half-life; normal,healthy; young; | DRUGBANK | Half-life | 2.0 | h | 2 | h | elimination half-life; normal,healthy; young; | DRUGBANK | Half-life | 6.2 | h | 6.2 | h | elimination half-life; normal,healthy; young; | DRUGBANK | Half-life | 2.6 | h | 2.6 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Protein Binding | 1.0 | % | 1 | % | plasma proteins; | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 1480.0 | ml/kg | 1480 | ml/kg | intra-arterial infusion | Ultravist Injection | iopromide | PDR |
| Max dose for children | 900.0 | ml/kg | 900 | ml/kg | intravenous injection, IV | Ultravist Injection | iopromide | PDR |
| Max dose for adolescents | 1480.0 | ml/kg | 1480 | ml/kg | intra-arterial infusion | Ultravist Injection | iopromide | PDR |
| Max dose for adolescents | 900.0 | ml/kg | 900 | ml/kg | intravenous injection, IV | Ultravist Injection | iopromide | PDR |
| Max dose for adults | 86000.0 | mg | 86 | g | total systemic | Ultravist Injection | iopromide | PDR |
| Max dose for geriatric | 86000.0 | mg | 86 | g | total systemic | Ultravist Injection | iopromide | PDR |