Basic Information
| Drug ID | DDPD09102 |
|
| Drug Name | Daclatasvir | |
| Molecular Weight | 738.89 | |
| Molecular Formula | C40H50N8O6 | |
| CAS Number | 1009119-64-5 | |
| SMILES | COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C1=NC=C(N1)C1=CC=C(C=C1)C1=CC=C(C=C1)C1=CN=C(N1)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)OC)C(C)C | |
| External Links | ||
| DRUGBANK | DB09102 | |
| PubChem Compound | 25154714 | |
| PDR | 3769 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Water Solubility | 7000.0 | mg/L | >700 | mg/ml | FDA Label |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 67.0 | % | 67 | % | Tablet, PO, oral; | DRUGBANK |
| T Max | 2.0 | h | <2 | h | Oral multiple dose; | DRUGBANK |
| Tss | 96.0 | h | 4 | day | PO, oral; | DRUGBANK |
| Clearance | 4.2 | L/h | 4.2 | L/h | Total clearance; PO, oral; | DRUGBANK | Clearance | 0.0600 | L/h/kg | 1 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 47.0 | L | 47.0 | L | Tablet, PO, oral; intravenous injection, IV; | DRUGBANK | Volume of Distribution | 0.67 | L/kg | 0.67 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 13.5 | h | ~12-15 | h | elimination half-life; Multiple dose; HCV-positive; | DRUGBANK | Half-life | 13.5 | h | 13.5 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 88.0 | % | ~88 | % | Faeces excretion; Bile excretion; | DRUGBANK | Eliminate Route | 6.6 | % | 6.6 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 99.0 | % | 99 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Frequency | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 90.0 | mg/day | 90 | mg/day | PO, oral | qd | Daklinza | daclatasvir | PDR |
| Max dose for geriatric | 90.0 | mg/day | 90 | mg/day | PO, oral | qd | Daklinza | daclatasvir | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1