Basic Information
| Drug ID | DDPD09082 |
|
| Drug Name | Vilanterol | |
| Molecular Weight | 486.43 | |
| Molecular Formula | C24H33Cl2NO5 | |
| CAS Number | 503068-34-6 | |
| SMILES | OCC1=C(O)C=CC(=C1)[C@@H](O)CNCCCCCCOCCOCC1=C(Cl)C=CC=C1Cl | |
| External Links | ||
| DRUGBANK | DB09082 | |
| PubChem Compound | 10184665 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 27.3 | % | 27.3 | % | inhalation, IH; | DRUGBANK | Bioavailability | 2.0 | % | <2 | % | PO, oral; | DRUGBANK |
| T Max | 0.17 | h | 10 | min | inhalation, IH; | DRUGBANK |
| Metabolic | 78.0 | % | 78 | % | DRUGBANK | Metabolic | 5.0 | % | 5 | % | DRUGBANK |
| Clearance | 1.5 | L/h/kg | 25.7 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 661.0 | L | 661.0 | L | Average volume of distribution; intravenous injection, IV; normal,healthy; | DRUGBANK | Volume of Distribution | 2.4 | L/kg | 2.38 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 21.3 | h | 21.3 | h | DRUGBANK | Half-life | 2.4 | h | 2.4 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 70.0 | % | 70 | % | Urinary excretion; PO, oral; | DRUGBANK | Eliminate Route | 30.0 | % | 30 | % | Faeces excretion; PO, oral; | DRUGBANK |
| Protein Binding | 93.9 | % | 93.9 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1