Basic Information
| Drug ID | DDPD09059 |
|
| Drug Name | Atosiban | |
| Molecular Weight | 994.19 | |
| Molecular Formula | C43H67N11O12S2 | |
| CAS Number | 90779-69-4 | |
| SMILES | [H][C@]1(NC(=O)[C@@]([H])(NC(=O)[C@@H](CC2=CC=C(OCC)C=C2)NC(=O)CCSSC[C@H](NC(=O)[C@H](CC(N)=O)NC1=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN)C(=O)NCC(N)=O)[C@@H](C)CC)[C@@H](C)O | |
| External Links | ||
| DRUGBANK | DB09059 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Css | 442.0 | ng/ml | 442.0 | ng/ml | intravenous infusion, IV in drop; Female, women; | DRUGBANK |
| Tss | 1.0 | h | 1 | h | intravenous infusion, IV in drop; Female, women; | DRUGBANK |
| Clearance | 41.8 | L/h | 41.8 | L/h | Average clearance; | DRUGBANK |
| Volume of Distribution | 41.8 | L | 41.8 | L | Average volume of distribution; | DRUGBANK |
| Half-life | 0.21 | h | 0.21 | h | distribution half-life; | DRUGBANK | Half-life | 1.7 | h | 1.7 | h | terminal half-life; | DRUGBANK |
| Protein Binding | 47.0 | % | 46-48 | % | plasma proteins; Preg, pregnant; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1