Basic Information
| Drug ID | DDPD09034 |
|
| Drug Name | Suvorexant | |
| Molecular Weight | 450.93 | |
| Molecular Formula | C23H23ClN6O2 | |
| CAS Number | 1030377-33-3 | |
| SMILES | [H][C@@]1(C)CCN(CCN1C(=O)C1=C(C=CC(C)=C1)N1N=CC=N1)C1=NC2=C(O1)C=CC(Cl)=C2 | |
| External Links | ||
| DRUGBANK | DB09034 | |
| PubChem Compound | 24965990 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Bioavailability | 82.0 | % | 82 | % | PO, oral; | DRUGBANK | |
| T Max | 2.0 | h | 2 | h | PO, oral; fasting; | DRUGBANK | T Max | 3.5 | h | 3.5 | h | PO, oral; high-fat meal; | high-fat meal ↑ ; | DRUGBANK |
| Clearance | 0.0504 | L/h/kg | 0.84 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Volume of Distribution | 49.0 | L | ~49 | L | Average volume of distribution; | DRUGBANK | Volume of Distribution | 0.69 | L/kg | 0.69 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 12.0 | h | ~12 | h | DRUGBANK | Half-life | 10.4 | h | 10.37 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 66.0 | % | ~66 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 23.0 | % | 23 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 99.0 | % | >99 | % | plasma proteins; human, homo sapiens; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1