Basic Information
| Drug ID | DDPD09030 |
|
| Drug Name | Vorapaxar | |
| Molecular Weight | 492.5817 | |
| Molecular Formula | C29H33FN2O4 | |
| CAS Number | 618385-01-6 | |
| SMILES | [H][C@@]12C[C@]3([H])C[C@@H](CC[C@@]3([H])[C@H](\C=C\C3=CC=C(C=N3)C3=CC(F)=CC=C3)[C@]1([H])[C@@H](C)OC2=O)NC(=O)OCC | |
| External Links | ||
| DRUGBANK | DB09030 | |
| PubChem Compound | 10077130 | |
| PDR | 3502 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 5.39 | - | 5.39 | - | ChEMBL |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Bioavailability | 100.0 | % | 100 | % | PO, oral; food; | food → ; | DRUGBANK |
| T Max | 1.0 | h | 1 | h | PO, oral; fasting; | DRUGBANK | |
| Clearance | 0.0204 | L/h/kg | 0.34 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Volume of Distribution | 424.0 | L | 424.0 | L | DRUGBANK | Volume of Distribution | 3.7 | L/kg | 3.74 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 84.0 | h | 3-4 | day | effective half-life; | DRUGBANK | Half-life | 192.0 | h | 8 | day | terminal half-life; | DRUGBANK | Half-life | 149.0 | h | 149 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Protein Binding | 99.0 | % | >99 | % | plasma proteins; human, homo sapiens; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 2.08 | mg/day | 2.08 | mg/day | PO, oral | Zontivity | vorapaxar | PDR |
| Max dose for geriatric | 2.08 | mg/day | 2.08 | mg/day | PO, oral | Zontivity | vorapaxar | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1