Basic Information
| Drug ID | DDPD08931 |
|
| Drug Name | Riociguat | |
| Molecular Weight | 422.4157 | |
| Molecular Formula | C20H19FN8O2 | |
| CAS Number | 625115-55-1 | |
| SMILES | COC(=O)N(C)C1=C(N)N=C(N=C1N)C1=NN(CC2=C(F)C=CC=C2)C2=C1C=CC=N2 | |
| External Links | ||
| DRUGBANK | DB08931 | |
| PubChem Compound | 11304743 | |
| PDR | 3355 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Water Solubility | 4.0 | mg/L | 4 | mg/L | FDA label |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Bioavailability | 94.0 | % | 94 | % | PO, oral; food; | food → ; | DRUGBANK |
| T Max | 1.5 | h | 1.5 | h | PO, oral; | DRUGBANK | |
| Clearance | 0.0444 | L/h/kg | 0.74 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Volume of Distribution | 30.0 | L | 30.0 | L | at steady state; | DRUGBANK | Volume of Distribution | 0.44 | L/kg | 0.44 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 12.0 | h | ~12 | h | patients; | DRUGBANK | Half-life | 7.0 | h | 7 | h | normal,healthy; | DRUGBANK | Half-life | 9.1 | h | 9.1 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 40.0 | % | 40 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 53.0 | % | 53 | % | Faeces excretion; | DRUGBANK |
| Protein Binding | 95.0 | % | 95 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Frequency | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 7.5 | mg/day | 2.5 | mg/dose | PO, oral | tid | Adempas | riociguat | PDR |
| Max dose for geriatric | 7.5 | mg/day | 2.5 | mg/dose | PO, oral | tid | Adempas | riociguat | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1