Basic Information
| Drug ID | DDPD08912 |
|
| Drug Name | Dabrafenib | |
| Molecular Weight | 519.562 | |
| Molecular Formula | C23H20F3N5O2S2 | |
| CAS Number | 1195765-45-7 | |
| SMILES | CC(C)(C)C1=NC(=C(S1)C1=NC(N)=NC=C1)C1=C(F)C(NS(=O)(=O)C2=C(F)C=CC=C2F)=CC=C1 | |
| External Links | ||
| DRUGBANK | DB08912 | |
| PubChem Compound | 44462760 | |
| PDR | 3160 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.9 | - | 2.9 | - | http://www.medsafe.govt.nz/profs/Datasheet/t/tafinlarcap.pdf |
| pKa | -1.5 | - | -1.5 | - | http://www.medsafe.govt.nz/profs/Datasheet/t/tafinlarcap.pdf |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 95.0 | % | 95 | % | PO, oral; | DRUGBANK |
| T Max | 2.0 | h | 2 | h | PO, oral; | DRUGBANK |
| Clearance | 17.0 | L/h | 17.0 | L/h | Single dose; | DRUGBANK | Clearance | 34.4 | L/h | 34.4 | L/h | Multiple dose; | DRUGBANK | Clearance | 0.17 | L/h/kg | 2.86 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 70.3 | L | 70.3 | L | Apparent volume of distribution; | DRUGBANK | Volume of Distribution | 0.65 | L/kg | 0.65 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 8.0 | h | 8 | h | terminal half-life; PO, oral; | DRUGBANK | Half-life | 2.6 | h | 2.6 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 2000.0 | mg/kg | >2000 | mg/kg | Rattus, Rat; | DRUGBANK |
| Protein Binding | 99.7 | % | 99.7 | % | plasma proteins; human, homo sapiens; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 300.0 | mg/day | 300 | mg/day | PO, oral | Tafinlar | dabrafenib | PDR |
| Max dose for geriatric | 300.0 | mg/day | 300 | mg/day | PO, oral | Tafinlar | dabrafenib | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1