Basic Information
| Drug ID | DDPD08907 |
|
| Drug Name | Canagliflozin | |
| Molecular Weight | 444.516 | |
| Molecular Formula | C24H25FO5S | |
| CAS Number | 842133-18-0 | |
| SMILES | [H][C@]1(O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C1=CC=C(C)C(CC2=CC=C(S2)C2=CC=C(F)C=C2)=C1 | |
| External Links | ||
| DRUGBANK | DB08907 | |
| PubChem Compound | 24812758 | |
| PDR | 3094 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 3.44 | - | 3.44 | - | https://www.tga.gov.au/file/824/download |
| Boiling Point | 642.9 | ℃ | 642.9±55.0 | ℃ | http://www.chemspider.com/Chemical-Structure.26333259.html |
| Melting Point | 70.0 | ℃ | 68-72 | ℃ | https://www.trc-canada.com/product-detail/?CatNum=C175190 |
| pKa | 13.34 | - | 13.34 | - | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL2103841/ |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 65.0 | % | 65 | % | PO, oral; | DRUGBANK |
| T Max | 4.5 | h | 4-5 | h | PO, oral; | DRUGBANK |
| Clearance | 11.5 | L/h | 192.0 | ml/min | intravenous injection, IV; normal,healthy; | DRUGBANK | Clearance | 0.0855 | L/h | 1.3-1.55 | ml/min | Renal clearance; | DRUGBANK | Clearance | 0.16 | L/h/kg | 2.74 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 83.5 | L | 83.5 | L | at steady state; intravenous injection, IV; Single dose; normal,healthy; patients; | DRUGBANK | Volume of Distribution | 1.2 | L/kg | 1.19 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 10.6 | h | 10.6 | h | terminal half-life; | DRUGBANK | Half-life | 13.1 | h | 13.1 | h | terminal half-life; | DRUGBANK | Half-life | 10.3 | h | 10.3 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 51.7 | % | 51.7 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 33.0 | % | ~33 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 1.0 | % | <1 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 99.0 | % | 99 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 300.0 | mg/day | 300 | mg/day | PO, oral | Invokana | canagliflozin | PDR |
| Max dose for geriatric | 300.0 | mg/day | 300 | mg/day | PO, oral | Invokana | canagliflozin | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1