Basic Information
| Drug ID | DDPD08901 |
|
| Drug Name | Ponatinib | |
| Molecular Weight | 532.5595 | |
| Molecular Formula | C29H27F3N6O | |
| CAS Number | 943319-70-8 | |
| SMILES | CN1CCN(CC2=CC=C(NC(=O)C3=CC(C#CC4=CN=C5C=CC=NN45)=C(C)C=C3)C=C2C(F)(F)F)CC1 | |
| External Links | ||
| DRUGBANK | DB08901 | |
| PubChem Compound | 24826799 | |
| PDR | 3155 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| pKa | 5.285 | - | 2.77,7.8 | - | FDA label |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 1253.0 | ng.h/ml | 1253.0 | ng.h/ml | DRUGBANK | |
| C Max | 73.0 | ng/ml | 73 | ng/ml | DRUGBANK | |
| T Max | 6.0 | h | 6 | h | PO, oral; | DRUGBANK |
| Metabolic | 64.0 | % | 64 | % | DRUGBANK | |
| Volume of Distribution | 1223.0 | L | 1223.0 | L | Steady state volume of distribution; PO, oral; tumor; patients; | DRUGBANK |
| Half-life | 24.0 | h | 24(12-66) | h | elimination half-life; tumor; patients; Oral multiple dose; | DRUGBANK |
| Eliminate Route | 87.0 | % | ~87 | % | Faeces excretion; Oral single dose; | DRUGBANK | Eliminate Route | 5.0 | % | ~5 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 99.0 | % | >99 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 45.0 | mg/day | 45 | mg/day | PO, oral | Iclusig | ponatinib | PDR |
| Max dose for adults | 30.0 | mg/day | 30 | mg/day | PO, oral | Iclusig | ponatinib | PDR |
| Max dose for geriatric | 45.0 | mg/day | 45 | mg/day | PO, oral | Iclusig | ponatinib | PDR |
| Max dose for geriatric | 30.0 | mg/day | 30 | mg/day | PO, oral | Iclusig | ponatinib | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1