Basic Information
| Drug ID | DDPD08896 |
|
| Drug Name | Regorafenib | |
| Molecular Weight | 482.815 | |
| Molecular Formula | C21H15ClF4N4O3 | |
| CAS Number | 755037-03-7 | |
| SMILES | CNC(=O)C1=CC(OC2=CC(F)=C(NC(=O)NC3=CC=C(Cl)C(=C3)C(F)(F)F)C=C2)=CC=N1 | |
| External Links | ||
| DRUGBANK | DB08896 | |
| PubChem Compound | 11167602 | |
| PDR | 2620 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 70400.0 | ng.h/ml | 70.4 | ug.h/ml | DRUGBANK | |
| C Max | 2500.0 | ng/ml | 2.5 | ug/ml | DRUGBANK | |
| Css | 3900.0 | ng/ml | 3.9 | ug/ml | DRUGBANK | |
| T Max | 4.0 | h | 4 | h | DRUGBANK | |
| Half-life | 28.0 | h | 28(14-58) | h | DRUGBANK | |
| Eliminate Route | 71.0 | % | ~71 | % | Faeces excretion; PO, oral; | DRUGBANK | Eliminate Route | 19.0 | % | 19 | % | Urinary excretion; PO, oral; | DRUGBANK |
| Protein Binding | 99.5 | % | 99.5 | % | plasma proteins; human, homo sapiens; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 160.0 | mg/day | 160 | mg/day | PO, oral; on days 1 to 21 | Stivarga | regorafenib | PDR |
| Max dose for geriatric | 160.0 | mg/day | 160 | mg/day | PO, oral; on days 1 to 21 | Stivarga | regorafenib | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1