Basic Information
| Drug ID | DDPD08884 |
|
| Drug Name | Gadoxetic acid | |
| Molecular Weight | 681.75 | |
| Molecular Formula | C23H30GdN3O11 | |
| CAS Number | 135326-11-3 | |
| SMILES | [Gd+3].[H][C@@](CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O)(CC1=CC=C(OCC)C=C1)N(CC(O)=O)CC(O)=O | |
| External Links | ||
| DRUGBANK | DB08884 | |
| PubChem Compound | 131704314 | |
| PDR | 1739 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| pKa | 7.4 | - | 6.8-8 | - | MSDS |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Metabolic | 0 | % | 0 | % | DRUGBANK | |
| Clearance | 15.0 | L/h | 250.0 | ml/min | Plasma clearance; | DRUGBANK | Clearance | 7.2 | L/h | 120.0 | ml/min | Renal clearance; | DRUGBANK |
| Volume of Distribution | 0.21 | L/kg | 0.21 | L/kg | Total volume of distribution; at steady state; | DRUGBANK |
| Half-life | 0.93 | h | 0.91-0.95 | h | elimination half-life; normal,healthy; adults; | DRUGBANK |
| Toxicity LD50 | 18100.0 | mg/kg | 18100.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 14500.0 | mg/kg | 14500.0 | mg/kg | PO, oral; mouse; | DRUGBANK | Toxicity LD50 | 5450.0 | mg/kg | 3600-7300 | mg/kg | intravenous injection, IV; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 8150.0 | mg/kg | 5400-10900 | mg/kg | intravenous injection, IV; mouse; | DRUGBANK | Toxicity LD50 | 2200.0 | mg/kg | >2200 | mg/kg | intravenous injection, IV; dog; | DRUGBANK |
| Protein Binding | 10.0 | % | <10 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for infants | 0.1 | ml/kg/dose | 0.1 | ml/kg/dose | intravenous injection, IV | Eovist | gadoxetate disodium | PDR |
| Max dose for infants | 0.025 | mmoL/kg/dose | 0.025 | mmoL/kg/dose | intravenous injection, IV | Eovist | gadoxetate disodium | PDR |
| Max dose for children | 0.1 | ml/kg/dose | 0.1 | ml/kg/dose | intravenous injection, IV | Eovist | gadoxetate disodium | PDR |
| Max dose for children | 0.025 | mmol/kg/dose | 0.025 | mmol/kg/dose | intravenous injection, IV | Eovist | gadoxetate disodium | PDR |
| Max dose for adolescents | 0.1 | ml/kg/dose | 0.1 | mL/kg/dose | intravenous injection, IV | Eovist | gadoxetate disodium | PDR |
| Max dose for adolescents | 0.025 | mmol/kg/dose | 0.025 | mmol/kg/dose | intravenous injection, IV | Eovist | gadoxetate disodium | PDR |
| Max dose for adults | 0.1 | ml/kg/dose | 0.1 | ml/kg/dose | intravenous injection, IV | Eovist | gadoxetate disodium | PDR |
| Max dose for adults | 0.025 | mmoL/kg/dose | 0.025 | mmoL/kg/dose | intravenous injection, IV | Eovist | gadoxetate disodium | PDR |
| Max dose for geriatric | 0.1 | ml/kg/dose | 0.1 | ml/kg/dose | intravenous injection, IV | Eovist | gadoxetate disodium | PDR |
| Max dose for geriatric | 0.025 | mmol/kg/dose | 0.025 | mmol/kg/dose | intravenous injection, IV | Eovist | gadoxetate disodium | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1