Basic Information
| Drug ID | DDPD08882 |
|
| Drug Name | Linagliptin | |
| Molecular Weight | 472.5422 | |
| Molecular Formula | C25H28N8O2 | |
| CAS Number | 668270-12-0 | |
| SMILES | CC#CCN1C(=NC2=C1C(=O)N(CC1=NC3=C(C=CC=C3)C(C)=N1)C(=O)N2C)N1CCC[C@@H](N)C1 | |
| External Links | ||
| DRUGBANK | DB08882 | |
| PubChem Compound | 10096344 | |
| PDR | 102 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Melting Point | 193.0 | ℃ | 190-196 | ℃ | http://www.chemspider.com/Chemical-Structure.8271879.html?rid=e059df1a-34ab-48c0-9c24-9d6c4d699c47&page_num=0 |
| Water Solubility | 1000.0 | mg/L | <1 | mg/ml | MSDS |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 30.0 | % | 30 | % | PO, oral; | DRUGBANK |
| Metabolic | 90.0 | % | 90 | % | Urinary excretion; Faeces excretion; | DRUGBANK |
| Clearance | 22.4 | L/h | 374.0 | ml/min | Total clearance; | DRUGBANK | Clearance | 0.11 | L/h/kg | 1.9 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 1110.0 | L | 1110.0 | L | intravenous injection, IV; Single dose; | DRUGBANK | Volume of Distribution | 960.0 | L | 380-1540 | L | intravenous infusion, IV in drop; Single dose; | DRUGBANK | Volume of Distribution | 16.0 | L/kg | 16 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 155.0 | h | 155 | h | terminal half-life; | DRUGBANK | Half-life | 129.0 | h | 129 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 84.7 | % | 84.7 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 5.4 | % | 5.4 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 99.0 | % | 99 | % | DRUGBANK | Protein Binding | 82.0 | % | 75-89 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 5.0 | mg/day | 5 | mg/day | PO, oral | Tradjenta | linagliptin | PDR |
| Max dose for geriatric | 5.0 | mg/day | 5 | mg/day | PO, oral | Tradjenta | linagliptin | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1