Basic Information
| Drug ID | DDPD08871 |
|
| Drug Name | Eribulin | |
| Molecular Weight | 729.908 | |
| Molecular Formula | C40H59NO11 | |
| CAS Number | 253128-41-5 | |
| SMILES | [H][C@@]12CC(=C)[C@]([H])(CC[C@@]3([H])C[C@@H](C)C(=C)[C@@]([H])(C[C@]4([H])O[C@H](C[C@H](O)CN)[C@H](OC)[C@@]4([H])CC(=O)C[C@@]4([H])CC[C@]5([H])O[C@@]6([H])[C@H]7O[C@@]8(C[C@]7([H])O[C@@]6([H])[C@@]([H])(O8)[C@@]5([H])O4)CC1)O3)O2 | |
| External Links | ||
| DRUGBANK | DB08871 | |
| PubChem Compound | 73425383 | |
| PDR | 143 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Clearance | 1.8 | L/h/m2 | 1.16-2.42 | L/h/m2 | DRUGBANK | Clearance | 0.0450 | L/h/kg | 0.75 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 78.5 | L/m2 | 43-114 | L/m2 | DRUGBANK | Volume of Distribution | 1.5 | L/kg | 1.46 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 40.0 | h | ~40 | h | DRUGBANK | Half-life | 37.8 | h | 37.8 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity NOAEL | 0.0150 | mg/kg/day | 0.015 | mg/kg/day | Rattus, Rat; | DRUGBANK | Toxicity NOAEL | 0.004500 | mg/kg/day | 0.0045 | mg/kg/day | dog; | DRUGBANK |
| Toxicity Lethal Dose | 0.75 | mg/kg | 0.75 | mg/kg | Single dose; Rattus, Rat; | DRUGBANK | Toxicity Lethal Dose | 0.0750 | mg/kg | 0.075 | mg/kg | Multiple dose; dog; | DRUGBANK |
| Protein Binding | 57.0 | % | 49-65 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 1.4 | mg/m2 | 1.4 | mg/m2 | intravenous injection, IV | Halaven | eribulin mesylate | PDR |
| Max dose for geriatric | 1.4 | mg/m2 | 1.4 | mg/m2 | intravenous injection, IV | Halaven | eribulin mesylate | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1