Basic Information
| Drug ID | DDPD08868 |
|
| Drug Name | Fingolimod | |
| Molecular Weight | 307.4708 | |
| Molecular Formula | C19H33NO2 | |
| CAS Number | 162359-55-9 | |
| SMILES | CCCCCCCCC1=CC=C(CCC(N)(CO)CO)C=C1 | |
| External Links | ||
| DRUGBANK | DB08868 | |
| PubChem Compound | 107970 | |
| PDR | 432 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 5.5 | - | 5.5 | - | https://www.ema.europa.eu/en/documents/variation-report/gilenya-h-c-2202-ii-0034-epar-assessment-report-variation_en.pdf |
| Boiling Point | 479.5 | ℃ | 479.5 | ℃ | https://www.lookchem.com/Fingolimod-hydrochloride/ |
| Melting Point | 104.5 | ℃ | 102-107 | ℃ | https://www.chemicalbook.com/ChemicalProductProperty_US_CB4244536.aspx |
| pKa | 8.0 | - | 8 | - | https://www.ema.europa.eu/en/documents/variation-report/gilenya-h-c-2202-ii-0034-epar-assessment-report-variation_en.pdf |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 91.5 | % | 90-93 | % | PO, oral; | DRUGBANK |
| T Max | 14.0 | h | 12-16 | h | PO, oral; | DRUGBANK |
| Tss | 1080.0 | h | 1-2 | month | PO, oral; | DRUGBANK |
| Clearance | 6.3 | L/h | 6.3±2.3 | L/h | DRUGBANK | Clearance | 0.0918 | L/h/kg | 1.53 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 1200.0 | L | 1200±260 | L | DRUGBANK | Volume of Distribution | 17.3 | L/kg | 17.3 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 180.0 | h | 6-9 | day | DRUGBANK | Half-life | 180.0 | h | 6-9 | day | Active metabolite; | DRUGBANK | Half-life | 144.0 | h | 144 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 450.0 | mg/kg | 300-600 | mg/kg | Rattus, Rat; | DRUGBANK |
| Protein Binding | 99.7 | % | >99.7 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 0.5 | mg/day | 0.5 | mg/day | PO, oral | Gilenya | fingolimod | PDR |
| Max dose for children | 0.25 | mg/day | 0.25 | mg/day | PO, oral | Gilenya | fingolimod | PDR |
| Max dose for adolescents | 0.5 | mg/day | 0.5 | mg/day | PO, oral | Gilenya | fingolimod | PDR |
| Max dose for adolescents | 0.25 | mg/day | 0.25 | mg/day | PO, oral | Gilenya | fingolimod | PDR |
| Max dose for adults | 0.5 | mg/day | 0.5 | mg/day | PO, oral | Gilenya | fingolimod | PDR |
| Max dose for geriatric | 0.5 | mg/day | 0.5 | mg/day | PO, oral | Gilenya | fingolimod | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1