Basic Information
| Drug ID | DDPD08828 |
|
| Drug Name | Vismodegib | |
| Molecular Weight | 421.297 | |
| Molecular Formula | C19H14Cl2N2O3S | |
| CAS Number | 879085-55-9 | |
| SMILES | CS(=O)(=O)C1=CC(Cl)=C(C=C1)C(=O)NC1=CC=C(Cl)C(=C1)C1=CC=CC=N1 | |
| External Links | ||
| DRUGBANK | DB08828 | |
| PubChem Compound | 24776445 | |
| PDR | 1516 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.7 | - | 2.7 | - | FDA label |
| Water Solubility | 0.1 | mg/L | 0.1 | μg/ml | FDA label |
| pKa | 3.8 | - | 3.8 | - | FDA label |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Bioavailability | 31.8 | % | 31.8 | % | PO, oral; food; | food → ; | DRUGBANK |
| Clearance | 0.000600 | L/h/kg | 0.01 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Volume of Distribution | 21.5 | L | 16.4-26.6 | L | DRUGBANK | Volume of Distribution | 0.23 | L/kg | 0.23 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 288.0 | h | 12 | day | Single dose; | DRUGBANK | Half-life | 96.0 | h | 4 | day | Multiple dose; | DRUGBANK | Half-life | 245.0 | h | 245 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 82.0 | % | 82 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 4.4 | % | 4.4 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 99.0 | % | 99 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 150.0 | mg/day | 150 | mg/day | PO, oral | Erivedge | vismodegib | PDR |
| Max dose for geriatric | 150.0 | mg/day | 150 | mg/day | PO, oral | Erivedge | vismodegib | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1