| Drug ID | DDPD06825 |
|
| Drug Name | Triptorelin | |
| Molecular Weight | 1311.473 | |
| Molecular Formula | C64H82N18O13 | |
| CAS Number | 57773-63-4 | |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](CC1=CNC2=CC=CC=C12)NC(=O)[C@H](CC1=CC=C(O)C=C1)NC(=O)[C@H](CO)NC(=O)[C@H](CC1=CNC2=C1C=CC=C2)NC(=O)[C@H](CC1=CNC=N1)NC(=O)[C@@H]1CCC(=O)N1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1CCC[C@H]1C(=O)NCC(N)=O | |
| External Links | ||
| DRUGBANK | DB06825 | |
| PubChem Compound | 25074470 | |
| PDR | 24136 | |
| Drugs.com | Drugs.com Drug Page | |
Not Available
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Clearance | 12.7 | L/h | 211.9 | ml/min | Total clearance; normal,healthy; Male, men; | DRUGBANK | Clearance | 0.16 | L/h/kg | 2.67 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 31.5 | L | 30-33 | L | intravenous injection, IV; Single dose; normal,healthy; Male, men; | DRUGBANK | Volume of Distribution | 0.40 | L/kg | 0.4 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 0.10 | h | 6 | min | distribution half-life; | DRUGBANK | Half-life | 0.75 | h | 45 | min | elimination half-life; | DRUGBANK | Half-life | 3.0 | h | 3 | h | terminal half-life; | DRUGBANK | Half-life | 2.8 | h | 2.81 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Frequency | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|---|
| Max dose for children | 22.5 | mg/dose | 22.5 | mg/dose | IM,intramuscular injection; nan | q24w | Triptodur | triptorelin | PDR |
| Max dose for adolescents | 22.5 | mg/dose | 22.5 | mg/dose | IM,intramuscular injection; nan | q24w | Triptodur | triptorelin | PDR |
| Max dose for adults | 0.133928571428571 | mg/day | 3.75 | mg/dose | IM,intramuscular injection; nan | q4w | Triptodur | triptorelin | PDR |
| Max dose for adults | 11.25 | mg/dose | 11.25 | mg/dose | IM,intramuscular injection; nan | q12w | Triptodur | triptorelin | PDR |
| Max dose for adults | 22.5 | mg/dose | 22.5 | mg/dose | IM,intramuscular injection; nan | q24w | Triptodur | triptorelin | PDR |
| Max dose for geriatric | 0.133928571428571 | mg/dose | 3.75 | mg/dose | IM,intramuscular injection | q4w | Triptodur | triptorelin | PDR |
| Max dose for geriatric | 11.25 | mg/dose | 11.25 | mg/dose | IM,intramuscular injection; nan | q12w | Triptodur | triptorelin | PDR |
| Max dose for geriatric | 22.5 | mg/dose | 22.5 | mg/dose | IM,intramuscular injection; nan | q24w | Triptodur | triptorelin | PDR |