Basic Information
| Drug ID | DDPD06813 |
|
| Drug Name | Pralatrexate | |
| Molecular Weight | 477.4726 | |
| Molecular Formula | C23H23N7O5 | |
| CAS Number | 146464-95-1 | |
| SMILES | NC1=NC2=NC=C(CC(CC#C)C3=CC=C(C=C3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)N=C2C(N)=N1 | |
| External Links | ||
| DRUGBANK | DB06813 | |
| PubChem Compound | 148121 | |
| PDR | 1200 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 16.5 | % | 13-20 | % | DRUGBANK | |
| Clearance | 11.5 | L/h | 191.0 | ml/min | DRUGBANK | Clearance | 25.0 | L/h | 417.0 | ml/min | DRUGBANK | Clearance | 13.2 | L/h | 220.0 | ml/min | Average clearance; | DRUGBANK |
| Volume of Distribution | 37.0 | L | 37.0 | L | DRUGBANK | Volume of Distribution | 105.0 | L | 105.0 | L | DRUGBANK |
| Half-life | 15.0 | h | 12-18 | h | DRUGBANK | |
| Eliminate Route | 35.0 | % | 35 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 76.5 | % | 67-86 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Frequency | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 30.0 | mg/m2 | 30 | mg/m2 | intravenous injection, IV | qw | Folotyn | pralatrexate | PDR |
| Max dose for elderly | 30.0 | mg/m2 | 30 | mg/m2 | intravenous injection, IV | qw | Folotyn | pralatrexate | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1