Basic Information
| Drug ID | DDPD06800 |
|
| Drug Name | Methylnaltrexone | |
| Molecular Weight | 356.441 | |
| Molecular Formula | C21H26NO4 | |
| CAS Number | 916055-93-1 | |
| SMILES | C[N@+]1(CC2CC2)CC[C@]23[C@H]4OC5=C(O)C=CC(C[C@@H]1[C@]2(O)CCC4=O)=C35 | |
| External Links | ||
| DRUGBANK | DB06800 | |
| PubChem Compound | 16089915 | |
| PDR | 503 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.2 | - | 2.2 | - | MSDS |
| Water Solubility | 5000.0 | mg/L | ≥5 | mg/ml | MSDS |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| AUC | 175.0 | ng.h/ml | 175.0 | ng.h/ml | DRUGBANK | ||
| C Max | 117.0 | ng/ml | 117 | ng/ml | DRUGBANK | ||
| T Max | 0.50 | h | 0.5 | h | increasing doses; | increasing doses → ; | DRUGBANK |
| Metabolic | 60.0 | % | 60 | % | DRUGBANK | Metabolic | 5.0 | % | 5 | % | DRUGBANK | Metabolic | 1.3 | % | 1.3 | % | DRUGBANK |
| Clearance | 0.63 | L/h/kg | 10.5±1.5 | ml/min/kg | intravenous injection, IV; | DRUGBANK | Clearance | 1.3 | L/h/kg | 22 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 1.1 | L/kg | 1.1 | L/kg | Steady state volume of distribution; | DRUGBANK | Volume of Distribution | 2.6 | L/kg | 2.6 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 8.9 | h | 8.89±2.59 | h | intravenous injection, IV; | DRUGBANK | Half-life | 7.5 | h | 6.14-8.83 | h | subcutaneous injection, SC; | DRUGBANK | Half-life | 2.5 | h | 2.5 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 50.0 | mg/kg | 50.0 | mg/kg | primate; | DRUGBANK | |
| Eliminate Route | 50.0 | % | ~50 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 50.0 | % | <50 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 85.0 | % | 85 | % | Unchanged drug; | DRUGBANK |
| Protein Binding | 13.0 | % | 11-15 | % | plasma proteins; human, homo sapiens; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 0.15 | mg/kg/day | 0.15 | mg/kg/day | subcutaneous injection, SC | Relistor | methylnaltrexone bromide | PDR |
| Max dose for adults | 8.0 | mg/day | 8 | mg/day | subcutaneous injection, SC | Relistor | methylnaltrexone bromide | PDR |
| Max dose for adults | 12.0 | mg/day | 12 | mg/day | subcutaneous injection, SC | Relistor | methylnaltrexone bromide | PDR |
| Max dose for adults | 0.15 | mg/kg/day | 0.15 | mg/kg/day | subcutaneous injection, SC | Relistor | methylnaltrexone bromide | PDR |
| Max dose for adults | 12.0 | mg/day | 12 | mg/day | subcutaneous injection, SC | Relistor | methylnaltrexone bromide | PDR |
| Max dose for adults | 450.0 | mg/day | 450 | mg/day | PO, oral | Relistor | methylnaltrexone bromide | PDR |
| Max dose for geriatric | 0.15 | mg/kg/day | 0.15 | mg/kg/day | subcutaneous injection, SC | Relistor | methylnaltrexone bromide | PDR |
| Max dose for geriatric | 8.0 | mg/day | 8 | mg/day | subcutaneous injection, SC | Relistor | methylnaltrexone bromide | PDR |
| Max dose for geriatric | 12.0 | mg/day | 12 | mg/day | subcutaneous injection, SC | Relistor | methylnaltrexone bromide | PDR |
| Max dose for geriatric | 0.15 | mg/kg/day | 0.15 | mg/kg/day | subcutaneous injection, SC | Relistor | methylnaltrexone bromide | PDR |
| Max dose for geriatric | 12.0 | mg/day | 12 | mg/day | subcutaneous injection, SC | Relistor | methylnaltrexone bromide | PDR |
| Max dose for geriatric | 450.0 | mg/day | 450 | mg/day | PO, oral | Relistor | methylnaltrexone bromide | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1